C24H34N8O3S — CID 66581947
2-[3-[[4-[2-oxo-6-(2-piperidin-4-ylsulfonylethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 66581947) has the molecular formula C24H34N8O3S and a molecular weight of 514.66 g/mol. Its IUPAC name is 2-[3-[[4-[2-oxo-6-(2-piperidin-4-ylsulfonylethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[2-oxo-6-(2-piperidin-4-ylsulfonylethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581947 |
| Molecular Formula | C24H34N8O3S |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 2-[3-[[4-[2-oxo-6-(2-piperidin-4-ylsulfonylethyl)-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(CCS(=O)(=O)C4CCNCC4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C24H34N8O3S/c25-23(26)29-10-1-9-28-15-17-2-4-20(5-3-17)32-16-18-14-19(30-22(18)31-24(32)33)8-13-36(34,35)21-6-11-27-12-7-21/h2-5,14,16,21,27-28H,1,6-13,15H2,(H4,25,26,29)(H,30,31,33) |
| InChIKey | XNXYIWWPOZNNHQ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 173.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|