C30H36N10O3 — CID 52953292
4-[3-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N-piperidin-4-ylbenzamide (PubChem CID 52953292) has the molecular formula C30H36N10O3 and a molecular weight of 584.69 g/mol. Its IUPAC name is 4-[3-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N-piperidin-4-ylbenzamide.
| Compound Name | 4-[3-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N-piperidin-4-ylbenzamide |
|---|---|
| PubChem CID | 52953292 |
| Molecular Formula | C30H36N10O3 |
| Molecular Weight | 584.69 g/mol |
| Exact Mass | 584.30 |
| IUPAC Name | 4-[3-[4-[[3-[[amino-(carbamoylamino)methylidene]amino]propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N-piperidin-4-ylbenzamide |
| SMILES | NC(=O)N/C(N)=N/CCCNCc1ccc(-n2cc3cc(-c4ccc(C(=O)NC5CCNCC5)cc4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C30H36N10O3/c31-28(39-29(32)42)35-13-1-12-34-17-19-2-8-24(9-3-19)40-18-22-16-25(37-26(22)38-30(40)43)20-4-6-21(7-5-20)27(41)36-23-10-14-33-15-11-23/h2-9,16,18,23,33-34H,1,10-15,17H2,(H,36,41)(H,37,38,43)(H5,31,32,35,39,42) |
| InChIKey | BKIKWCILESSHSL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 197.34 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.69 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|