C24H35N9O — CID 70645648
2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 70645648) has the molecular formula C24H35N9O and a molecular weight of 465.61 g/mol. Its IUPAC name is 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 70645648 |
| Molecular Formula | C24H35N9O |
| Molecular Weight | 465.61 g/mol |
| Exact Mass | 465.30 |
| IUPAC Name | 2-[3-[[4-[2-oxo-6-[2-(piperidin-4-ylamino)ethyl]-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(CCNC4CCNCC4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C24H35N9O/c25-23(26)30-10-1-9-28-15-17-2-4-21(5-3-17)33-16-18-14-20(31-22(18)32-24(33)34)8-13-29-19-6-11-27-12-7-19/h2-5,14,16,19,27-29H,1,6-13,15H2,(H4,25,26,30)(H,31,32,34) |
| InChIKey | SMXFRYBBXUVKTH-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 151.17 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.61 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|