C29H34F3N11O — CID 53377572
3-[[1-[4-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide (PubChem CID 53377572) has the molecular formula C29H34F3N11O and a molecular weight of 609.66 g/mol. Its IUPAC name is 3-[[1-[4-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide.
| Compound Name | 3-[[1-[4-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 53377572 |
| Molecular Formula | C29H34F3N11O |
| Molecular Weight | 609.66 g/mol |
| Exact Mass | 609.29 |
| IUPAC Name | 3-[[1-[4-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)N1CC(NC(c2ccc(-c3cc4cn(-c5ccc(CNCCCN=C(N)N)cc5)c(=O)nc4[nH]3)cc2)C(F)(F)F)C1 |
| InChI | InChI=1S/C29H34F3N11O/c30-29(31,32)24(39-21-15-42(16-21)27(35)36)19-6-4-18(5-7-19)23-12-20-14-43(28(44)41-25(20)40-23)22-8-2-17(3-9-22)13-37-10-1-11-38-26(33)34/h2-9,12,14,21,24,37,39H,1,10-11,13,15-16H2,(H3,35,36)(H4,33,34,38)(H,40,41,44) |
| InChIKey | JLQIQPCGDZEFTM-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 192.25 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.66 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|