C31H36F3N9O — CID 149090619
3-[[1-[4-[3-[3-(7-amino-7-iminoheptyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide (PubChem CID 149090619) has the molecular formula C31H36F3N9O and a molecular weight of 607.69 g/mol. Its IUPAC name is 3-[[1-[4-[3-[3-(7-amino-7-iminoheptyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide.
| Compound Name | 3-[[1-[4-[3-[3-(7-amino-7-iminoheptyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
|---|---|
| PubChem CID | 149090619 |
| Molecular Formula | C31H36F3N9O |
| Molecular Weight | 607.69 g/mol |
| Exact Mass | 607.30 |
| IUPAC Name | 3-[[1-[4-[3-[3-(7-amino-7-iminoheptyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]phenyl]-2,2,2-trifluoroethyl]amino]azetidine-1-carboximidamide |
| SMILES | [H]/N=C(\N)CCCCCCc1cccc(-n2cc3cc(-c4ccc(C(NC5CN(/C(N)=N/[H])C5)C(F)(F)F)cc4)[nH]c3nc2=O)c1 |
| InChI | InChI=1S/C31H36F3N9O/c32-31(33,34)27(39-23-17-42(18-23)29(37)38)21-12-10-20(11-13-21)25-15-22-16-43(30(44)41-28(22)40-25)24-8-5-7-19(14-24)6-3-1-2-4-9-26(35)36/h5,7-8,10-16,23,27,39H,1-4,6,9,17-18H2,(H3,35,36)(H3,37,38)(H,40,41,44) |
| InChIKey | QSHFHSTVFQXFDF-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 165.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.69 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|