C29H35F3N8O2 — CID 71475679
2-[3-[[(1R)-1-[4-[6-[3-(4-aminobutyl)-5-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 71475679) has the molecular formula C29H35F3N8O2 and a molecular weight of 584.65 g/mol. Its IUPAC name is 2-[3-[[(1R)-1-[4-[6-[3-(4-aminobutyl)-5-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1R)-1-[4-[6-[3-(4-aminobutyl)-5-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 71475679 |
| Molecular Formula | C29H35F3N8O2 |
| Molecular Weight | 584.65 g/mol |
| Exact Mass | 584.28 |
| IUPAC Name | 2-[3-[[(1R)-1-[4-[6-[3-(4-aminobutyl)-5-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | C[C@@H](NCCCN=C(N)N)c1ccc(-n2cc3cc(-c4cc(CCCCN)cc(OC(F)(F)F)c4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C29H35F3N8O2/c1-18(36-11-4-12-37-27(34)35)20-6-8-23(9-7-20)40-17-22-16-25(38-26(22)39-28(40)41)21-13-19(5-2-3-10-33)14-24(15-21)42-29(30,31)32/h6-9,13-18,36H,2-5,10-12,33H2,1H3,(H4,34,35,37)(H,38,39,41)/t18-/m1/s1 |
| InChIKey | FLOPBHMOEKNNLS-GOSISDBHSA-N |
| XLogP | 3.87 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|