C32H38F4N8O2 — CID 122428614
2-[(3S)-3-[[(1S)-1-[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]pent-4-enyl]guanidine (PubChem CID 122428614) has the molecular formula C32H38F4N8O2 and a molecular weight of 642.70 g/mol. Its IUPAC name is 2-[(3S)-3-[[(1S)-1-[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]pent-4-enyl]guanidine.
| Compound Name | 2-[(3S)-3-[[(1S)-1-[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]pent-4-enyl]guanidine |
|---|---|
| PubChem CID | 122428614 |
| Molecular Formula | C32H38F4N8O2 |
| Molecular Weight | 642.70 g/mol |
| Exact Mass | 642.31 |
| IUPAC Name | 2-[(3S)-3-[[(1S)-1-[4-[6-[5-[(4S)-4-aminopentyl]-2-fluoro-3-(trifluoromethoxy)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]pent-4-enyl]guanidine |
| SMILES | C=C[C@H](CCN=C(N)N)N[C@@H](C)c1ccc(-n2cc3cc(-c4cc(CCC[C@H](C)N)cc(OC(F)(F)F)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C32H38F4N8O2/c1-4-23(12-13-40-30(38)39)41-19(3)21-8-10-24(11-9-21)44-17-22-16-26(42-29(22)43-31(44)45)25-14-20(7-5-6-18(2)37)15-27(28(25)33)46-32(34,35)36/h4,8-11,14-19,23,41H,1,5-7,12-13,37H2,2-3H3,(H4,38,39,40)(H,42,43,45)/t18-,19-,23+/m0/s1 |
| InChIKey | RWZBZSAOYWXTTB-SFYKDHMMSA-N |
| XLogP | 4.96 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.70 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|