C30H37F3N8O2 — CID 122428712
2-[3-[[(1S)-1-[4-[6-[3-[(1R,4R)-4-amino-1-hydroxypentyl]-5-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 122428712) has the molecular formula C30H37F3N8O2 and a molecular weight of 598.67 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[6-[3-[(1R,4R)-4-amino-1-hydroxypentyl]-5-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[6-[3-[(1R,4R)-4-amino-1-hydroxypentyl]-5-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 122428712 |
| Molecular Formula | C30H37F3N8O2 |
| Molecular Weight | 598.67 g/mol |
| Exact Mass | 598.30 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[6-[3-[(1R,4R)-4-amino-1-hydroxypentyl]-5-(trifluoromethyl)phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | C[C@H](NCCCN=C(N)N)c1ccc(-n2cc3cc(-c4cc([C@H](O)CC[C@@H](C)N)cc(C(F)(F)F)c4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C30H37F3N8O2/c1-17(34)4-9-26(42)21-12-20(13-23(14-21)30(31,32)33)25-15-22-16-41(29(43)40-27(22)39-25)24-7-5-19(6-8-24)18(2)37-10-3-11-38-28(35)36/h5-8,12-18,26,37,42H,3-4,9-11,34H2,1-2H3,(H4,35,36,38)(H,39,40,43)/t17-,18+,26-/m1/s1 |
| InChIKey | KDHYGCQVRKUEKZ-FIAZIHOUSA-N |
| XLogP | 3.87 |
| TPSA | 173.36 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.67 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|