C23H33N7O — CID 134389872
2-[3-[[(1S)-1-[4-(2-oxo-6-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]butyl]amino]propyl]guanidine (PubChem CID 134389872) has the molecular formula C23H33N7O and a molecular weight of 423.57 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-(2-oxo-6-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]butyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-(2-oxo-6-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]butyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 134389872 |
| Molecular Formula | C23H33N7O |
| Molecular Weight | 423.57 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-(2-oxo-6-propan-2-yl-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]butyl]amino]propyl]guanidine |
| SMILES | CCC[C@H](NCCCN=C(N)N)c1ccc(-n2cc3cc(C(C)C)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C23H33N7O/c1-4-6-19(26-11-5-12-27-22(24)25)16-7-9-18(10-8-16)30-14-17-13-20(15(2)3)28-21(17)29-23(30)31/h7-10,13-15,19,26H,4-6,11-12H2,1-3H3,(H4,24,25,27)(H,28,29,31)/t19-/m0/s1 |
| InChIKey | WPLVMQKJBIWQMH-IBGZPJMESA-N |
| XLogP | 2.93 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.57 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|