C26H39N9O — CID 122428298
2-[3-[[(1S)-1-[4-[6-[(3R)-1-[(2R)-3-amino-2-methylpropyl]pyrrolidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 122428298) has the molecular formula C26H39N9O and a molecular weight of 493.66 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[6-[(3R)-1-[(2R)-3-amino-2-methylpropyl]pyrrolidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[6-[(3R)-1-[(2R)-3-amino-2-methylpropyl]pyrrolidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 122428298 |
| Molecular Formula | C26H39N9O |
| Molecular Weight | 493.66 g/mol |
| Exact Mass | 493.33 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[6-[(3R)-1-[(2R)-3-amino-2-methylpropyl]pyrrolidin-3-yl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | C[C@H](CN)CN1CC[C@@H](c2cc3cn(-c4ccc([C@H](C)NCCCN=C(N)N)cc4)c(=O)nc3[nH]2)C1 |
| InChI | InChI=1S/C26H39N9O/c1-17(13-27)14-34-11-8-20(15-34)23-12-21-16-35(26(36)33-24(21)32-23)22-6-4-19(5-7-22)18(2)30-9-3-10-31-25(28)29/h4-7,12,16-18,20,30H,3,8-11,13-15,27H2,1-2H3,(H4,28,29,31)(H,32,33,36)/t17-,18+,20-/m1/s1 |
| InChIKey | GAPMHNYEEATLPJ-WSTZPKSXSA-N |
| XLogP | 1.41 |
| TPSA | 156.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.66 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|