C20H27N7O — CID 134389806
2-[3-[1-[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propylamino]propyl]guanidine (PubChem CID 134389806) has the molecular formula C20H27N7O and a molecular weight of 381.48 g/mol. Its IUPAC name is 2-[3-[1-[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propylamino]propyl]guanidine.
| Compound Name | 2-[3-[1-[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propylamino]propyl]guanidine |
|---|---|
| PubChem CID | 134389806 |
| Molecular Formula | C20H27N7O |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.23 |
| IUPAC Name | 2-[3-[1-[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]propylamino]propyl]guanidine |
| SMILES | CCC(NCCCN=C(N)N)c1ccc(-n2cc3cc(C)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C20H27N7O/c1-3-17(23-9-4-10-24-19(21)22)14-5-7-16(8-6-14)27-12-15-11-13(2)25-18(15)26-20(27)28/h5-8,11-12,17,23H,3-4,9-10H2,1-2H3,(H4,21,22,24)(H,25,26,28) |
| InChIKey | ZLTAZASUYNLXKC-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|