C22H32N10O — CID 118527335
2-[3-[3-(diaminomethylideneamino)propyl-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methyl]amino]propyl]guanidine (PubChem CID 118527335) has the molecular formula C22H32N10O and a molecular weight of 452.57 g/mol. Its IUPAC name is 2-[3-[3-(diaminomethylideneamino)propyl-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[3-(diaminomethylideneamino)propyl-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 118527335 |
| Molecular Formula | C22H32N10O |
| Molecular Weight | 452.57 g/mol |
| Exact Mass | 452.28 |
| IUPAC Name | 2-[3-[3-(diaminomethylideneamino)propyl-[[4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methyl]amino]propyl]guanidine |
| SMILES | Cc1cc2cn(-c3ccc(CN(CCCN=C(N)N)CCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C22H32N10O/c1-15-12-17-14-32(22(33)30-19(17)29-15)18-6-4-16(5-7-18)13-31(10-2-8-27-20(23)24)11-3-9-28-21(25)26/h4-7,12,14H,2-3,8-11,13H2,1H3,(H4,23,24,27)(H4,25,26,28)(H,29,30,33) |
| InChIKey | WABCTLOHOWSOIS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 182.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.57 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|