C17H19N7O2 — CID 118527307
N-[2-(diaminomethylideneamino)ethyl]-4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)benzamide (PubChem CID 118527307) has the molecular formula C17H19N7O2 and a molecular weight of 353.39 g/mol. Its IUPAC name is N-[2-(diaminomethylideneamino)ethyl]-4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)benzamide.
| Compound Name | N-[2-(diaminomethylideneamino)ethyl]-4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)benzamide |
|---|---|
| PubChem CID | 118527307 |
| Molecular Formula | C17H19N7O2 |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-[2-(diaminomethylideneamino)ethyl]-4-(6-methyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)benzamide |
| SMILES | Cc1cc2cn(-c3ccc(C(=O)NCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C17H19N7O2/c1-10-8-12-9-24(17(26)23-14(12)22-10)13-4-2-11(3-5-13)15(25)20-6-7-21-16(18)19/h2-5,8-9H,6-7H2,1H3,(H,20,25)(H4,18,19,21)(H,22,23,26) |
| InChIKey | JZTDPEQYBHEGHR-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 144.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|