C21H29N7O2 — CID 134389822
2-[3-[[(1R)-1-[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]-3-hydroxypropyl]amino]propyl]guanidine (PubChem CID 134389822) has the molecular formula C21H29N7O2 and a molecular weight of 411.51 g/mol. Its IUPAC name is 2-[3-[[(1R)-1-[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]-3-hydroxypropyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1R)-1-[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]-3-hydroxypropyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 134389822 |
| Molecular Formula | C21H29N7O2 |
| Molecular Weight | 411.51 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 2-[3-[[(1R)-1-[4-(6-ethyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]-3-hydroxypropyl]amino]propyl]guanidine |
| SMILES | CCc1cc2cn(-c3ccc([C@@H](CCO)NCCCN=C(N)N)cc3)c(=O)nc2[nH]1 |
| InChI | InChI=1S/C21H29N7O2/c1-2-16-12-15-13-28(21(30)27-19(15)26-16)17-6-4-14(5-7-17)18(8-11-29)24-9-3-10-25-20(22)23/h4-7,12-13,18,24,29H,2-3,8-11H2,1H3,(H4,22,23,25)(H,26,27,30)/t18-/m1/s1 |
| InChIKey | CJHSVJKOFLZMDZ-GOSISDBHSA-N |
| XLogP | 0.95 |
| TPSA | 147.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.51 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|