C36H51N9O4S — CID 158650740
4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]benzamide;4-tert-butyl-N-piperidin-4-ylbenzenesulfonamide (PubChem CID 158650740) has the molecular formula C36H51N9O4S and a molecular weight of 705.93 g/mol. Its IUPAC name is 4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]benzamide;4-tert-butyl-N-piperidin-4-ylbenzenesulfonamide.
| Compound Name | 4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]benzamide;4-tert-butyl-N-piperidin-4-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 158650740 |
| Molecular Formula | C36H51N9O4S |
| Molecular Weight | 705.93 g/mol |
| Exact Mass | 705.38 |
| IUPAC Name | 4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)-N-[3-(diaminomethylideneamino)propyl]benzamide;4-tert-butyl-N-piperidin-4-ylbenzenesulfonamide |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(C(=O)NCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(C)c1ccc(S(=O)(=O)NC2CCNCC2)cc1 |
| InChI | InChI=1S/C21H27N7O2.C15H24N2O2S/c1-21(2,3)16-11-14-12-28(20(30)27-17(14)26-16)15-7-5-13(6-8-15)18(29)24-9-4-10-25-19(22)23;1-15(2,3)12-4-6-14(7-5-12)20(18,19)17-13-8-10-16-11-9-13/h5-8,11-12H,4,9-10H2,1-3H3,(H,24,29)(H4,22,23,25)(H,26,27,30);4-7,13,16-17H,8-11H2,1-3H3 |
| InChIKey | IBNDVCATNNMOAP-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 202.38 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.93 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|