C36H53N9O3S — CID 157325174
2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;4-tert-butyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide (PubChem CID 157325174) has the molecular formula C36H53N9O3S and a molecular weight of 691.95 g/mol. Its IUPAC name is 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;4-tert-butyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide.
| Compound Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;4-tert-butyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 157325174 |
| Molecular Formula | C36H53N9O3S |
| Molecular Weight | 691.95 g/mol |
| Exact Mass | 691.40 |
| IUPAC Name | 2-[3-[[4-(6-tert-butyl-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine;4-tert-butyl-N-[(3S)-piperidin-3-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1cc2cn(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)nc2[nH]1.CC(C)(C)c1ccc(S(=O)(=O)N[C@H]2CCCNC2)cc1 |
| InChI | InChI=1S/C21H29N7O.C15H24N2O2S/c1-21(2,3)17-11-15-13-28(20(29)27-18(15)26-17)16-7-5-14(6-8-16)12-24-9-4-10-25-19(22)23;1-15(2,3)12-6-8-14(9-7-12)20(18,19)17-13-5-4-10-16-11-13/h5-8,11,13,24H,4,9-10,12H2,1-3H3,(H4,22,23,25)(H,26,27,29);6-9,13,16-17H,4-5,10-11H2,1-3H3/t;13-/m.0/s1 |
| InChIKey | BEQAFVLXODBVRN-RSJBZBQMSA-N |
| XLogP | 3.78 |
| TPSA | 185.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.95 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|