C32H39ClFN7O — CID 122450443
2-[3-[[(1S)-1-[4-[6-[3-chloro-5-(4-ethylcyclohexyl)-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 122450443) has the molecular formula C32H39ClFN7O and a molecular weight of 592.16 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[6-[3-chloro-5-(4-ethylcyclohexyl)-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[6-[3-chloro-5-(4-ethylcyclohexyl)-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 122450443 |
| Molecular Formula | C32H39ClFN7O |
| Molecular Weight | 592.16 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[6-[3-chloro-5-(4-ethylcyclohexyl)-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | CCC1CCC(c2cc(Cl)c(F)c(-c3cc4cn(-c5ccc([C@H](C)NCCCN=C(N)N)cc5)c(=O)nc4[nH]3)c2)CC1 |
| InChI | InChI=1S/C32H39ClFN7O/c1-3-20-5-7-22(8-6-20)23-15-26(29(34)27(33)16-23)28-17-24-18-41(32(42)40-30(24)39-28)25-11-9-21(10-12-25)19(2)37-13-4-14-38-31(35)36/h9-12,15-20,22,37H,3-8,13-14H2,1-2H3,(H4,35,36,38)(H,39,40,42)/t19-,20?,22?/m0/s1 |
| InChIKey | AERJYUNZIWGFHC-YMISUZCDSA-N |
| XLogP | 6.17 |
| TPSA | 127.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.16 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|