C29H34ClFN8O2 — CID 122428149
2-[3-[[(1S)-1-[4-[6-[5-[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine (PubChem CID 122428149) has the molecular formula C29H34ClFN8O2 and a molecular weight of 581.10 g/mol. Its IUPAC name is 2-[3-[[(1S)-1-[4-[6-[5-[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine.
| Compound Name | 2-[3-[[(1S)-1-[4-[6-[5-[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
|---|---|
| PubChem CID | 122428149 |
| Molecular Formula | C29H34ClFN8O2 |
| Molecular Weight | 581.10 g/mol |
| Exact Mass | 580.25 |
| IUPAC Name | 2-[3-[[(1S)-1-[4-[6-[5-[(2S,5R)-5-(aminomethyl)oxolan-2-yl]-3-chloro-2-fluorophenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]ethyl]amino]propyl]guanidine |
| SMILES | C[C@H](NCCCN=C(N)N)c1ccc(-n2cc3cc(-c4cc([C@@H]5CC[C@H](CN)O5)cc(Cl)c4F)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C29H34ClFN8O2/c1-16(35-9-2-10-36-28(33)34)17-3-5-20(6-4-17)39-15-19-13-24(37-27(19)38-29(39)40)22-11-18(12-23(30)26(22)31)25-8-7-21(14-32)41-25/h3-6,11-13,15-16,21,25,35H,2,7-10,14,32H2,1H3,(H4,33,34,36)(H,37,38,40)/t16-,21+,25-/m0/s1 |
| InChIKey | LTVUBOPYLYLIGW-LMNXFLSBSA-N |
| XLogP | 3.67 |
| TPSA | 162.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.10 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|