C30H38N10O2 — CID 66581454
3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N,N-dimethyl-5-piperazin-1-ylbenzamide (PubChem CID 66581454) has the molecular formula C30H38N10O2 and a molecular weight of 570.70 g/mol. Its IUPAC name is 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N,N-dimethyl-5-piperazin-1-ylbenzamide.
| Compound Name | 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N,N-dimethyl-5-piperazin-1-ylbenzamide |
|---|---|
| PubChem CID | 66581454 |
| Molecular Formula | C30H38N10O2 |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | 3-[3-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-6-yl]-N,N-dimethyl-5-piperazin-1-ylbenzamide |
| SMILES | CN(C)C(=O)c1cc(-c2cc3cn(-c4ccc(CNCCCN=C(N)N)cc4)c(=O)nc3[nH]2)cc(N2CCNCC2)c1 |
| InChI | InChI=1S/C30H38N10O2/c1-38(2)28(41)22-14-21(15-25(16-22)39-12-10-33-11-13-39)26-17-23-19-40(30(42)37-27(23)36-26)24-6-4-20(5-7-24)18-34-8-3-9-35-29(31)32/h4-7,14-17,19,33-34H,3,8-13,18H2,1-2H3,(H4,31,32,35)(H,36,37,42) |
| InChIKey | QTSVVUHBKQGKOM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 162.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|