C29H35N9O3 — CID 66581793
2-[3-[[4-[6-[3-[(2-morpholin-4-yl-2-oxoethyl)amino]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine (PubChem CID 66581793) has the molecular formula C29H35N9O3 and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-[3-[[4-[6-[3-[(2-morpholin-4-yl-2-oxoethyl)amino]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-[6-[3-[(2-morpholin-4-yl-2-oxoethyl)amino]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 66581793 |
| Molecular Formula | C29H35N9O3 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.29 |
| IUPAC Name | 2-[3-[[4-[6-[3-[(2-morpholin-4-yl-2-oxoethyl)amino]phenyl]-2-oxo-7H-pyrrolo[2,3-d]pyrimidin-3-yl]phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3cc(-c4cccc(NCC(=O)N5CCOCC5)c4)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C29H35N9O3/c30-28(31)33-10-2-9-32-17-20-5-7-24(8-6-20)38-19-22-16-25(35-27(22)36-29(38)40)21-3-1-4-23(15-21)34-18-26(39)37-11-13-41-14-12-37/h1,3-8,15-16,19,32,34H,2,9-14,17-18H2,(H4,30,31,33)(H,35,36,40) |
| InChIKey | WOCGLCBWHXFDKC-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 168.68 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|