C16H18IN5O — CID 118700030
3-[4-[(3-aminopropylamino)methyl]phenyl]-6-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-one (PubChem CID 118700030) has the molecular formula C16H18IN5O and a molecular weight of 423.26 g/mol. Its IUPAC name is 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-one.
| Compound Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 118700030 |
| Molecular Formula | C16H18IN5O |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | 3-[4-[(3-aminopropylamino)methyl]phenyl]-6-iodo-7H-pyrrolo[2,3-d]pyrimidin-2-one |
| SMILES | NCCCNCc1ccc(-n2cc3cc(I)[nH]c3nc2=O)cc1 |
| InChI | InChI=1S/C16H18IN5O/c17-14-8-12-10-22(16(23)21-15(12)20-14)13-4-2-11(3-5-13)9-19-7-1-6-18/h2-5,8,10,19H,1,6-7,9,18H2,(H,20,21,23) |
| InChIKey | HIUIYKQDTWCWFW-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 88.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|