C24H33N7O2 — CID 134446982
2-[3-[[4-(6-morpholin-2-yl-2-oxo-8,9-dihydro-7H-cyclohepta[d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 134446982) has the molecular formula C24H33N7O2 and a molecular weight of 451.58 g/mol. Its IUPAC name is 2-[3-[[4-(6-morpholin-2-yl-2-oxo-8,9-dihydro-7H-cyclohepta[d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 2-[3-[[4-(6-morpholin-2-yl-2-oxo-8,9-dihydro-7H-cyclohepta[d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 134446982 |
| Molecular Formula | C24H33N7O2 |
| Molecular Weight | 451.58 g/mol |
| Exact Mass | 451.27 |
| IUPAC Name | 2-[3-[[4-(6-morpholin-2-yl-2-oxo-8,9-dihydro-7H-cyclohepta[d]pyrimidin-3-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | NC(N)=NCCCNCc1ccc(-n2cc3c(nc2=O)CCCC(C2CNCCO2)=C3)cc1 |
| InChI | InChI=1S/C24H33N7O2/c25-23(26)29-10-2-9-27-14-17-5-7-20(8-6-17)31-16-19-13-18(22-15-28-11-12-33-22)3-1-4-21(19)30-24(31)32/h5-8,13,16,22,27-28H,1-4,9-12,14-15H2,(H4,25,26,29) |
| InChIKey | WIBRKQNXHMJEOX-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 132.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.58 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|