C23H25N7O3S — CID 137006971
4-[6-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-7-oxo-8H-imidazo[1,2-a]pyrimidin-2-yl]benzenesulfinic acid (PubChem CID 137006971) has the molecular formula C23H25N7O3S and a molecular weight of 479.57 g/mol. Its IUPAC name is 4-[6-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-7-oxo-8H-imidazo[1,2-a]pyrimidin-2-yl]benzenesulfinic acid.
| Compound Name | 4-[6-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-7-oxo-8H-imidazo[1,2-a]pyrimidin-2-yl]benzenesulfinic acid |
|---|---|
| PubChem CID | 137006971 |
| Molecular Formula | C23H25N7O3S |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | 4-[6-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-7-oxo-8H-imidazo[1,2-a]pyrimidin-2-yl]benzenesulfinic acid |
| SMILES | NC(N)=NCCCNCc1ccc(-c2cn3cc(-c4ccc(S(=O)O)cc4)nc3[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H25N7O3S/c24-22(25)27-11-1-10-26-12-15-2-4-16(5-3-15)19-13-30-14-20(28-23(30)29-21(19)31)17-6-8-18(9-7-17)34(32)33/h2-9,13-14,26H,1,10-12H2,(H,32,33)(H4,24,25,27)(H,28,29,31) |
| InChIKey | SMBJHDLBZLIDPR-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 163.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|