C25H30F2N8O3 — CID 118591664
1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2,5-difluoro-4-methylphenoxy)ethyl]urea (PubChem CID 118591664) has the molecular formula C25H30F2N8O3 and a molecular weight of 528.56 g/mol. Its IUPAC name is 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2,5-difluoro-4-methylphenoxy)ethyl]urea.
| Compound Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2,5-difluoro-4-methylphenoxy)ethyl]urea |
|---|---|
| PubChem CID | 118591664 |
| Molecular Formula | C25H30F2N8O3 |
| Molecular Weight | 528.56 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | 1-[5-[4-[[3-(diaminomethylideneamino)propylamino]methyl]phenyl]-6-oxo-1H-pyrimidin-2-yl]-3-[2-(2,5-difluoro-4-methylphenoxy)ethyl]urea |
| SMILES | Cc1cc(F)c(OCCNC(=O)Nc2ncc(-c3ccc(CNCCCN=C(N)N)cc3)c(=O)[nH]2)cc1F |
| InChI | InChI=1S/C25H30F2N8O3/c1-15-11-20(27)21(12-19(15)26)38-10-9-32-25(37)35-24-33-14-18(22(36)34-24)17-5-3-16(4-6-17)13-30-7-2-8-31-23(28)29/h3-6,11-12,14,30H,2,7-10,13H2,1H3,(H4,28,29,31)(H3,32,33,34,35,36,37) |
| InChIKey | ZYJIBERWUMPUAM-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 172.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.56 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|