C35H55N9O3S — CID 161346303
1-[2-(3-aminopropoxy)-4-(methylsulfanylmethyl)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine (PubChem CID 161346303) has the molecular formula C35H55N9O3S and a molecular weight of 681.95 g/mol. Its IUPAC name is 1-[2-(3-aminopropoxy)-4-(methylsulfanylmethyl)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine.
| Compound Name | 1-[2-(3-aminopropoxy)-4-(methylsulfanylmethyl)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 161346303 |
| Molecular Formula | C35H55N9O3S |
| Molecular Weight | 681.95 g/mol |
| Exact Mass | 681.41 |
| IUPAC Name | 1-[2-(3-aminopropoxy)-4-(methylsulfanylmethyl)phenyl]-3-tert-butylurea;2-[3-[[4-(2-tert-butyl-6-oxo-1H-pyrimidin-5-yl)phenyl]methylamino]propyl]guanidine |
| SMILES | CC(C)(C)c1ncc(-c2ccc(CNCCCN=C(N)N)cc2)c(=O)[nH]1.CSCc1ccc(NC(=O)NC(C)(C)C)c(OCCCN)c1 |
| InChI | InChI=1S/C19H28N6O.C16H27N3O2S/c1-19(2,3)17-24-12-15(16(26)25-17)14-7-5-13(6-8-14)11-22-9-4-10-23-18(20)21;1-16(2,3)19-15(20)18-13-7-6-12(11-22-4)10-14(13)21-9-5-8-17/h5-8,12,22H,4,9-11H2,1-3H3,(H4,20,21,23)(H,24,25,26);6-7,10H,5,8-9,11,17H2,1-4H3,(H2,18,19,20) |
| InChIKey | VNILCXIRQMDESU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 198.56 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.95 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|