C22H23F3N6O2 — CID 118591706
1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,5-difluoro-4-methylphenyl)urea (PubChem CID 118591706) has the molecular formula C22H23F3N6O2 and a molecular weight of 460.46 g/mol. Its IUPAC name is 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,5-difluoro-4-methylphenyl)urea.
| Compound Name | 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,5-difluoro-4-methylphenyl)urea |
|---|---|
| PubChem CID | 118591706 |
| Molecular Formula | C22H23F3N6O2 |
| Molecular Weight | 460.46 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[5-[4-[(3-aminopropylamino)methyl]-2-fluorophenyl]-6-oxo-1H-pyrimidin-2-yl]-3-(2,5-difluoro-4-methylphenyl)urea |
| SMILES | Cc1cc(F)c(NC(=O)Nc2ncc(-c3ccc(CNCCCN)cc3F)c(=O)[nH]2)cc1F |
| InChI | InChI=1S/C22H23F3N6O2/c1-12-7-18(25)19(9-16(12)23)29-22(33)31-21-28-11-15(20(32)30-21)14-4-3-13(8-17(14)24)10-27-6-2-5-26/h3-4,7-9,11,27H,2,5-6,10,26H2,1H3,(H3,28,29,30,31,32,33) |
| InChIKey | GECHRMBRVCIRSA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.46 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|