C23H27F3N6O — CID 89492759
5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one (PubChem CID 89492759) has the molecular formula C23H27F3N6O and a molecular weight of 460.50 g/mol. Its IUPAC name is 5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one.
| Compound Name | 5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 89492759 |
| Molecular Formula | C23H27F3N6O |
| Molecular Weight | 460.50 g/mol |
| Exact Mass | 460.22 |
| IUPAC Name | 5-[4-[[bis(3-aminopropyl)amino]methyl]phenyl]-2-(2,4,5-trifluoroanilino)-1H-pyrimidin-6-one |
| SMILES | NCCCN(CCCN)Cc1ccc(-c2cnc(Nc3cc(F)c(F)cc3F)[nH]c2=O)cc1 |
| InChI | InChI=1S/C23H27F3N6O/c24-18-11-20(26)21(12-19(18)25)30-23-29-13-17(22(33)31-23)16-5-3-15(4-6-16)14-32(9-1-7-27)10-2-8-28/h3-6,11-13H,1-2,7-10,14,27-28H2,(H2,29,30,31,33) |
| InChIKey | QUNVSPALSIEOCX-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|