C10H16N2O — CID 66489379
1,3,6-trimethyl-4,5,6,7-tetrahydroindazol-4-ol (PubChem CID 66489379) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 1,3,6-trimethyl-4,5,6,7-tetrahydroindazol-4-ol.
| Compound Name | 1,3,6-trimethyl-4,5,6,7-tetrahydroindazol-4-ol |
|---|---|
| PubChem CID | 66489379 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 1,3,6-trimethyl-4,5,6,7-tetrahydroindazol-4-ol |
| SMILES | Cc1nn(C)c2c1C(O)CC(C)C2 |
| InChI | InChI=1S/C10H16N2O/c1-6-4-8-10(9(13)5-6)7(2)11-12(8)3/h6,9,13H,4-5H2,1-3H3 |
| InChIKey | KBHFBRLFDKGRHQ-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |