C10H8N4O3 — CID 66489384
4-(methoxymethyl)-11-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66489384) has the molecular formula C10H8N4O3 and a molecular weight of 232.20 g/mol. Its IUPAC name is 4-(methoxymethyl)-11-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 4-(methoxymethyl)-11-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66489384 |
| Molecular Formula | C10H8N4O3 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 4-(methoxymethyl)-11-oxa-2,3,5,7-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COCc1nc2ncc3c(=O)occc3n2n1 |
| InChI | InChI=1S/C10H8N4O3/c1-16-5-8-12-10-11-4-6-7(14(10)13-8)2-3-17-9(6)15/h2-4H,5H2,1H3 |
| InChIKey | BMSPETYMICCXKC-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |