C17H14N4 — CID 66493687
1-(4-pyridin-3-ylpyrimidin-2-yl)-2,3-dihydroindole (PubChem CID 66493687) has the molecular formula C17H14N4 and a molecular weight of 274.33 g/mol. Its IUPAC name is 1-(4-pyridin-3-ylpyrimidin-2-yl)-2,3-dihydroindole.
| Compound Name | 1-(4-pyridin-3-ylpyrimidin-2-yl)-2,3-dihydroindole |
|---|---|
| PubChem CID | 66493687 |
| Molecular Formula | C17H14N4 |
| Molecular Weight | 274.33 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 1-(4-pyridin-3-ylpyrimidin-2-yl)-2,3-dihydroindole |
| SMILES | c1cncc(-c2ccnc(N3CCc4ccccc43)n2)c1 |
| InChI | InChI=1S/C17H14N4/c1-2-6-16-13(4-1)8-11-21(16)17-19-10-7-15(20-17)14-5-3-9-18-12-14/h1-7,9-10,12H,8,11H2 |
| InChIKey | WJRWJMHTLPOOMN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 41.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.33 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |