C19H16ClN3O — CID 66494087
4-[(E)-2-(4-chlorophenyl)ethenyl]-N-(4-methoxyphenyl)pyrimidin-2-amine (PubChem CID 66494087) has the molecular formula C19H16ClN3O and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-[(E)-2-(4-chlorophenyl)ethenyl]-N-(4-methoxyphenyl)pyrimidin-2-amine.
| Compound Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-N-(4-methoxyphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 66494087 |
| Molecular Formula | C19H16ClN3O |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 4-[(E)-2-(4-chlorophenyl)ethenyl]-N-(4-methoxyphenyl)pyrimidin-2-amine |
| SMILES | COc1ccc(Nc2nccc(/C=C/c3ccc(Cl)cc3)n2)cc1 |
| InChI | InChI=1S/C19H16ClN3O/c1-24-18-10-8-16(9-11-18)22-19-21-13-12-17(23-19)7-4-14-2-5-15(20)6-3-14/h2-13H,1H3,(H,21,22,23)/b7-4+ |
| InChIKey | MWKPUZGEMHYIKK-QPJJXVBHSA-N |
| XLogP | 5.05 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |