C20H15F2N3O2 — CID 66494844
5-(3,4-difluorophenyl)-4-methyl-2-(3-methylphenyl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 66494844) has the molecular formula C20H15F2N3O2 and a molecular weight of 367.36 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-4-methyl-2-(3-methylphenyl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 5-(3,4-difluorophenyl)-4-methyl-2-(3-methylphenyl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 66494844 |
| Molecular Formula | C20H15F2N3O2 |
| Molecular Weight | 367.36 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 5-(3,4-difluorophenyl)-4-methyl-2-(3-methylphenyl)-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1cccc(-n2[nH]c3cc(=O)n(-c4ccc(F)c(F)c4)c(C)c3c2=O)c1 |
| InChI | InChI=1S/C20H15F2N3O2/c1-11-4-3-5-14(8-11)25-20(27)19-12(2)24(18(26)10-17(19)23-25)13-6-7-15(21)16(22)9-13/h3-10,23H,1-2H3 |
| InChIKey | WACRBCUTYBJMIJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.36 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|