C19H13F2N3O2 — CID 66495077
2,5-bis(3-fluorophenyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione (PubChem CID 66495077) has the molecular formula C19H13F2N3O2 and a molecular weight of 353.33 g/mol. Its IUPAC name is 2,5-bis(3-fluorophenyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione.
| Compound Name | 2,5-bis(3-fluorophenyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
|---|---|
| PubChem CID | 66495077 |
| Molecular Formula | C19H13F2N3O2 |
| Molecular Weight | 353.33 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 2,5-bis(3-fluorophenyl)-4-methyl-1H-pyrazolo[4,3-c]pyridine-3,6-dione |
| SMILES | Cc1c2c(=O)n(-c3cccc(F)c3)[nH]c2cc(=O)n1-c1cccc(F)c1 |
| InChI | InChI=1S/C19H13F2N3O2/c1-11-18-16(10-17(25)23(11)14-6-2-4-12(20)8-14)22-24(19(18)26)15-7-3-5-13(21)9-15/h2-10,22H,1H3 |
| InChIKey | KGRXBKFRHXLDIP-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 59.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.33 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het_65_B(7)', 'substructure': 'N/A'} |
|---|