C16H18N4O2 — CID 66495586
ethyl 2-(cyanoamino)-6-methyl-4-(3-methylphenyl)-1,4-dihydropyrimidine-5-carboxylate (PubChem CID 66495586) has the molecular formula C16H18N4O2 and a molecular weight of 298.35 g/mol. Its IUPAC name is ethyl 2-(cyanoamino)-6-methyl-4-(3-methylphenyl)-1,4-dihydropyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(cyanoamino)-6-methyl-4-(3-methylphenyl)-1,4-dihydropyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 66495586 |
| Molecular Formula | C16H18N4O2 |
| Molecular Weight | 298.35 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | ethyl 2-(cyanoamino)-6-methyl-4-(3-methylphenyl)-1,4-dihydropyrimidine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(NC#N)=NC1c1cccc(C)c1 |
| InChI | InChI=1S/C16H18N4O2/c1-4-22-15(21)13-11(3)19-16(18-9-17)20-14(13)12-7-5-6-10(2)8-12/h5-8,14H,4H2,1-3H3,(H2,18,19,20) |
| InChIKey | VSMFULPZBYIXGT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 86.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.35 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|