C16H10BrN3O2S — CID 664956
N-[2-(5-bromofuran-2-yl)-3H-benzimidazol-5-yl]thiophene-2-carboxamide (PubChem CID 664956) has the molecular formula C16H10BrN3O2S and a molecular weight of 388.25 g/mol. Its IUPAC name is N-[2-(5-bromofuran-2-yl)-3H-benzimidazol-5-yl]thiophene-2-carboxamide.
| Compound Name | N-[2-(5-bromofuran-2-yl)-3H-benzimidazol-5-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 664956 |
| Molecular Formula | C16H10BrN3O2S |
| Molecular Weight | 388.25 g/mol |
| Exact Mass | 386.97 |
| IUPAC Name | N-[2-(5-bromofuran-2-yl)-3H-benzimidazol-5-yl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccc(Br)o3)[nH]c2c1)c1cccs1 |
| InChI | InChI=1S/C16H10BrN3O2S/c17-14-6-5-12(22-14)15-19-10-4-3-9(8-11(10)20-15)18-16(21)13-2-1-7-23-13/h1-8H,(H,18,21)(H,19,20) |
| InChIKey | HXIGHGWYYQERKO-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.25 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |