C16H11N3O2S — CID 828646
N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)furan-2-carboxamide (PubChem CID 828646) has the molecular formula C16H11N3O2S and a molecular weight of 309.35 g/mol. Its IUPAC name is N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)furan-2-carboxamide.
| Compound Name | N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 828646 |
| Molecular Formula | C16H11N3O2S |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-(2-thiophen-2-yl-3H-benzimidazol-5-yl)furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3cccs3)[nH]c2c1)c1ccco1 |
| InChI | InChI=1S/C16H11N3O2S/c20-16(13-3-1-7-21-13)17-10-5-6-11-12(9-10)19-15(18-11)14-4-2-8-22-14/h1-9H,(H,17,20)(H,18,19) |
| InChIKey | LMQKIWHZTIQKJA-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |