C17H15N5O2 — CID 66496392
11-(2-methoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496392) has the molecular formula C17H15N5O2 and a molecular weight of 321.34 g/mol. Its IUPAC name is 11-(2-methoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(2-methoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496392 |
| Molecular Formula | C17H15N5O2 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 11-(2-methoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | COc1ccccc1-n1ccc2c(c(C)nc3nc(C)nn32)c1=O |
| InChI | InChI=1S/C17H15N5O2/c1-10-15-13(22-17(18-10)19-11(2)20-22)8-9-21(16(15)23)12-6-4-5-7-14(12)24-3/h4-9H,1-3H3 |
| InChIKey | JPTWCLICNIWFMT-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |