C18H17N5O — CID 66496483
11-(2,4-dimethylphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496483) has the molecular formula C18H17N5O and a molecular weight of 319.37 g/mol. Its IUPAC name is 11-(2,4-dimethylphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(2,4-dimethylphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496483 |
| Molecular Formula | C18H17N5O |
| Molecular Weight | 319.37 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | 11-(2,4-dimethylphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | Cc1ccc(-n2ccc3c(c(C)nc4nc(C)nn43)c2=O)c(C)c1 |
| InChI | InChI=1S/C18H17N5O/c1-10-5-6-14(11(2)9-10)22-8-7-15-16(17(22)24)12(3)19-18-20-13(4)21-23(15)18/h5-9H,1-4H3 |
| InChIKey | LJCPBFICNOBREP-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 65.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.37 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |