C18H17N5O2 — CID 66496415
11-(4-ethoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one (PubChem CID 66496415) has the molecular formula C18H17N5O2 and a molecular weight of 335.37 g/mol. Its IUPAC name is 11-(4-ethoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one.
| Compound Name | 11-(4-ethoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
|---|---|
| PubChem CID | 66496415 |
| Molecular Formula | C18H17N5O2 |
| Molecular Weight | 335.37 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 11-(4-ethoxyphenyl)-4,8-dimethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-10-one |
| SMILES | CCOc1ccc(-n2ccc3c(c(C)nc4nc(C)nn43)c2=O)cc1 |
| InChI | InChI=1S/C18H17N5O2/c1-4-25-14-7-5-13(6-8-14)22-10-9-15-16(17(22)24)11(2)19-18-20-12(3)21-23(15)18/h5-10H,4H2,1-3H3 |
| InChIKey | MFRTZEABLNGOHK-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 74.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |