C21H21N5O3 — CID 66496430
butyl 4-(4,8-dimethyl-10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzoate (PubChem CID 66496430) has the molecular formula C21H21N5O3 and a molecular weight of 391.43 g/mol. Its IUPAC name is butyl 4-(4,8-dimethyl-10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzoate.
| Compound Name | butyl 4-(4,8-dimethyl-10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzoate |
|---|---|
| PubChem CID | 66496430 |
| Molecular Formula | C21H21N5O3 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | butyl 4-(4,8-dimethyl-10-oxo-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)benzoate |
| SMILES | CCCCOC(=O)c1ccc(-n2ccc3c(c(C)nc4nc(C)nn43)c2=O)cc1 |
| InChI | InChI=1S/C21H21N5O3/c1-4-5-12-29-20(28)15-6-8-16(9-7-15)25-11-10-17-18(19(25)27)13(2)22-21-23-14(3)24-26(17)21/h6-11H,4-5,12H2,1-3H3 |
| InChIKey | RRVJOZRWSMWHSK-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 91.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|