C15H14N4O — CID 66498200
11-(4-methoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene (PubChem CID 66498200) has the molecular formula C15H14N4O and a molecular weight of 266.30 g/mol. Its IUPAC name is 11-(4-methoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene.
| Compound Name | 11-(4-methoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
|---|---|
| PubChem CID | 66498200 |
| Molecular Formula | C15H14N4O |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 11-(4-methoxyphenyl)-1,8,10,12-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraene |
| SMILES | COc1ccc(-c2nc3ncc4c(n3n2)CCC4)cc1 |
| InChI | InChI=1S/C15H14N4O/c1-20-12-7-5-10(6-8-12)14-17-15-16-9-11-3-2-4-13(11)19(15)18-14/h5-9H,2-4H2,1H3 |
| InChIKey | LGGPTPRQRXSZCQ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 52.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |