C14H12ClN5 — CID 103317209
4-(3-chlorophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene (PubChem CID 103317209) has the molecular formula C14H12ClN5 and a molecular weight of 285.74 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene.
| Compound Name | 4-(3-chlorophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
|---|---|
| PubChem CID | 103317209 |
| Molecular Formula | C14H12ClN5 |
| Molecular Weight | 285.74 g/mol |
| Exact Mass | 285.08 |
| IUPAC Name | 4-(3-chlorophenyl)-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7-tetraene |
| SMILES | Clc1cccc(-c2nc3ncc4c(n3n2)CCNC4)c1 |
| InChI | InChI=1S/C14H12ClN5/c15-11-3-1-2-9(6-11)13-18-14-17-8-10-7-16-5-4-12(10)20(14)19-13/h1-3,6,8,16H,4-5,7H2 |
| InChIKey | JPCDHDYQNZUNDU-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.74 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |