C12H7ClN6O — CID 136859539
4-(3-chlorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one (PubChem CID 136859539) has the molecular formula C12H7ClN6O and a molecular weight of 286.68 g/mol. Its IUPAC name is 4-(3-chlorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one.
| Compound Name | 4-(3-chlorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
|---|---|
| PubChem CID | 136859539 |
| Molecular Formula | C12H7ClN6O |
| Molecular Weight | 286.68 g/mol |
| Exact Mass | 286.04 |
| IUPAC Name | 4-(3-chlorophenyl)-3,5,6,8,10,11-hexazatricyclo[7.3.0.02,6]dodeca-1(9),2,4,11-tetraen-7-one |
| SMILES | O=c1[nH]c2[nH]ncc2c2nc(-c3cccc(Cl)c3)nn12 |
| InChI | InChI=1S/C12H7ClN6O/c13-7-3-1-2-6(4-7)9-15-11-8-5-14-17-10(8)16-12(20)19(11)18-9/h1-5H,(H2,14,16,17,20) |
| InChIKey | JERZRIWNYWAEHQ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 91.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.68 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |