C17H19N7O — CID 66499434
(4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)-(4-phenylpiperazin-1-yl)methanone (PubChem CID 66499434) has the molecular formula C17H19N7O and a molecular weight of 337.39 g/mol. Its IUPAC name is (4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)-(4-phenylpiperazin-1-yl)methanone.
| Compound Name | (4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)-(4-phenylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 66499434 |
| Molecular Formula | C17H19N7O |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (4,7-dimethyl-[1,2,4]triazolo[5,1-c][1,2,4]triazin-3-yl)-(4-phenylpiperazin-1-yl)methanone |
| SMILES | Cc1nc2nnc(C(=O)N3CCN(c4ccccc4)CC3)c(C)n2n1 |
| InChI | InChI=1S/C17H19N7O/c1-12-15(19-20-17-18-13(2)21-24(12)17)16(25)23-10-8-22(9-11-23)14-6-4-3-5-7-14/h3-7H,8-11H2,1-2H3 |
| InChIKey | DPBXCQBOAXAJKK-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 79.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |