C15H16N4O3 — CID 66504635
methyl 4-methyl-10-oxo-11-propyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate (PubChem CID 66504635) has the molecular formula C15H16N4O3 and a molecular weight of 300.32 g/mol. Its IUPAC name is methyl 4-methyl-10-oxo-11-propyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate.
| Compound Name | methyl 4-methyl-10-oxo-11-propyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate |
|---|---|
| PubChem CID | 66504635 |
| Molecular Formula | C15H16N4O3 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | methyl 4-methyl-10-oxo-11-propyl-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaene-5-carboxylate |
| SMILES | CCCn1ccc2c(cnc3c(C(=O)OC)c(C)nn32)c1=O |
| InChI | InChI=1S/C15H16N4O3/c1-4-6-18-7-5-11-10(14(18)20)8-16-13-12(15(21)22-3)9(2)17-19(11)13/h5,7-8H,4,6H2,1-3H3 |
| InChIKey | BNIINLZALDGWFZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |