C15H14N4O5 — CID 66505754
2-(5-methoxycarbonyl-4-methyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)propanoic acid (PubChem CID 66505754) has the molecular formula C15H14N4O5 and a molecular weight of 330.30 g/mol. Its IUPAC name is 2-(5-methoxycarbonyl-4-methyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)propanoic acid.
| Compound Name | 2-(5-methoxycarbonyl-4-methyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)propanoic acid |
|---|---|
| PubChem CID | 66505754 |
| Molecular Formula | C15H14N4O5 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(5-methoxycarbonyl-4-methyl-10-oxo-2,3,7,11-tetrazatricyclo[7.4.0.02,6]trideca-1(9),3,5,7,12-pentaen-11-yl)propanoic acid |
| SMILES | COC(=O)c1c(C)nn2c1ncc1c(=O)n(C(C)C(=O)O)ccc12 |
| InChI | InChI=1S/C15H14N4O5/c1-7-11(15(23)24-3)12-16-6-9-10(19(12)17-7)4-5-18(13(9)20)8(2)14(21)22/h4-6,8H,1-3H3,(H,21,22) |
| InChIKey | PLZLVSABCGVRFH-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |