C16H15N5OS — CID 665047
N-(furan-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine (PubChem CID 665047) has the molecular formula C16H15N5OS and a molecular weight of 325.40 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine.
| Compound Name | N-(furan-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
|---|---|
| PubChem CID | 665047 |
| Molecular Formula | C16H15N5OS |
| Molecular Weight | 325.40 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | N-(furan-2-ylmethyl)-10-thia-3,5,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,4,7,11(16)-pentaen-7-amine |
| SMILES | c1coc(CNc2nc3sc4c(c3c3ncnn23)CCCC4)c1 |
| InChI | InChI=1S/C16H15N5OS/c1-2-6-12-11(5-1)13-14-18-9-19-21(14)16(20-15(13)23-12)17-8-10-4-3-7-22-10/h3-4,7,9H,1-2,5-6,8H2,(H,17,20) |
| InChIKey | BHZQDIWPVGIXOR-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 68.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |