C17H24N4O — CID 66505793
N-cyclohexyl-2-(3,6-dihydro-2H-pyridin-1-yl)-4-methylpyrimidine-5-carboxamide (PubChem CID 66505793) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,6-dihydro-2H-pyridin-1-yl)-4-methylpyrimidine-5-carboxamide.
| Compound Name | N-cyclohexyl-2-(3,6-dihydro-2H-pyridin-1-yl)-4-methylpyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 66505793 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | N-cyclohexyl-2-(3,6-dihydro-2H-pyridin-1-yl)-4-methylpyrimidine-5-carboxamide |
| SMILES | Cc1nc(N2CC=CCC2)ncc1C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C17H24N4O/c1-13-15(16(22)20-14-8-4-2-5-9-14)12-18-17(19-13)21-10-6-3-7-11-21/h3,6,12,14H,2,4-5,7-11H2,1H3,(H,20,22) |
| InChIKey | LRVOORXKPZNEIA-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|