C21H12F2N4O2 — CID 66506633
5-(3,5-difluorophenyl)-11-methyl-3-phenyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66506633) has the molecular formula C21H12F2N4O2 and a molecular weight of 390.35 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-11-methyl-3-phenyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 5-(3,5-difluorophenyl)-11-methyl-3-phenyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66506633 |
| Molecular Formula | C21H12F2N4O2 |
| Molecular Weight | 390.35 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 5-(3,5-difluorophenyl)-11-methyl-3-phenyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | CN1C(=O)c2cnc3c(c(-c4ccccc4)nn3-c3cc(F)cc(F)c3)c2C1=O |
| InChI | InChI=1S/C21H12F2N4O2/c1-26-20(28)15-10-24-19-17(16(15)21(26)29)18(11-5-3-2-4-6-11)25-27(19)14-8-12(22)7-13(23)9-14/h2-10H,1H3 |
| InChIKey | CXRWVOIGGSXWDU-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.35 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|