C22H14F2N4O3 — CID 66507343
5-(3,5-difluorophenyl)-3-(4-methoxyphenyl)-11-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione (PubChem CID 66507343) has the molecular formula C22H14F2N4O3 and a molecular weight of 420.38 g/mol. Its IUPAC name is 5-(3,5-difluorophenyl)-3-(4-methoxyphenyl)-11-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione.
| Compound Name | 5-(3,5-difluorophenyl)-3-(4-methoxyphenyl)-11-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
|---|---|
| PubChem CID | 66507343 |
| Molecular Formula | C22H14F2N4O3 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 420.10 |
| IUPAC Name | 5-(3,5-difluorophenyl)-3-(4-methoxyphenyl)-11-methyl-4,5,7,11-tetrazatricyclo[7.3.0.02,6]dodeca-1,3,6,8-tetraene-10,12-dione |
| SMILES | COc1ccc(-c2nn(-c3cc(F)cc(F)c3)c3ncc4c(c23)C(=O)N(C)C4=O)cc1 |
| InChI | InChI=1S/C22H14F2N4O3/c1-27-21(29)16-10-25-20-18(17(16)22(27)30)19(11-3-5-15(31-2)6-4-11)26-28(20)14-8-12(23)7-13(24)9-14/h3-10H,1-2H3 |
| InChIKey | FSCJOQMOUGJFRF-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 77.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|